C10H6F5NO3 — CID 6612355
4-(2,2,3,3,3-pentafluoropropanoylamino)benzoic acid (PubChem CID 6612355) has the molecular formula C10H6F5NO3 and a molecular weight of 283.15 g/mol. Its IUPAC name is 4-(2,2,3,3,3-pentafluoropropanoylamino)benzoic acid.
| Compound Name | 4-(2,2,3,3,3-pentafluoropropanoylamino)benzoic acid |
|---|---|
| PubChem CID | 6612355 |
| Molecular Formula | C10H6F5NO3 |
| Molecular Weight | 283.15 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | 4-(2,2,3,3,3-pentafluoropropanoylamino)benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H6F5NO3/c11-9(12,10(13,14)15)8(19)16-6-3-1-5(2-4-6)7(17)18/h1-4H,(H,16,19)(H,17,18) |
| InChIKey | ZQDHKYUQWHFJRN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.15 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|