C9H4F7NO — CID 114038120
N-(3,5-difluorophenyl)-2,2,3,3,3-pentafluoropropanamide (PubChem CID 114038120) has the molecular formula C9H4F7NO and a molecular weight of 275.12 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-2,2,3,3,3-pentafluoropropanamide.
| Compound Name | N-(3,5-difluorophenyl)-2,2,3,3,3-pentafluoropropanamide |
|---|---|
| PubChem CID | 114038120 |
| Molecular Formula | C9H4F7NO |
| Molecular Weight | 275.12 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | N-(3,5-difluorophenyl)-2,2,3,3,3-pentafluoropropanamide |
| SMILES | O=C(Nc1cc(F)cc(F)c1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H4F7NO/c10-4-1-5(11)3-6(2-4)17-7(18)8(12,13)9(14,15)16/h1-3H,(H,17,18) |
| InChIKey | WOHABPAHVOOEBP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.12 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|