C9H4Cl2F5NO — CID 14274634
N-(3,4-dichlorophenyl)-2,2,3,3,3-pentafluoropropanamide (PubChem CID 14274634) has the molecular formula C9H4Cl2F5NO and a molecular weight of 308.03 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2,2,3,3,3-pentafluoropropanamide.
| Compound Name | N-(3,4-dichlorophenyl)-2,2,3,3,3-pentafluoropropanamide |
|---|---|
| PubChem CID | 14274634 |
| Molecular Formula | C9H4Cl2F5NO |
| Molecular Weight | 308.03 g/mol |
| Exact Mass | 306.96 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2,2,3,3,3-pentafluoropropanamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H4Cl2F5NO/c10-5-2-1-4(3-6(5)11)17-7(18)8(12,13)9(14,15)16/h1-3H,(H,17,18) |
| InChIKey | AZBWSUJXZKMFES-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.03 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|