C9H5F6NO — CID 532140
2,2,3,3,3-pentafluoro-N-(4-fluorophenyl)propanamide (PubChem CID 532140) has the molecular formula C9H5F6NO and a molecular weight of 257.13 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-N-(4-fluorophenyl)propanamide.
| Compound Name | 2,2,3,3,3-pentafluoro-N-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 532140 |
| Molecular Formula | C9H5F6NO |
| Molecular Weight | 257.13 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-N-(4-fluorophenyl)propanamide |
| SMILES | O=C(Nc1ccc(F)cc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H5F6NO/c10-5-1-3-6(4-2-5)16-7(17)8(11,12)9(13,14)15/h1-4H,(H,16,17) |
| InChIKey | PBUZXWZWAZFUOL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.13 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|