C12H5ClF11NO — CID 3278706
6-chloro-2,2,3,3,4,4,5,5,6,6-decafluoro-N-(4-fluorophenyl)hexanamide (PubChem CID 3278706) has the molecular formula C12H5ClF11NO and a molecular weight of 423.61 g/mol. Its IUPAC name is 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluoro-N-(4-fluorophenyl)hexanamide.
| Compound Name | 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluoro-N-(4-fluorophenyl)hexanamide |
|---|---|
| PubChem CID | 3278706 |
| Molecular Formula | C12H5ClF11NO |
| Molecular Weight | 423.61 g/mol |
| Exact Mass | 422.99 |
| IUPAC Name | 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluoro-N-(4-fluorophenyl)hexanamide |
| SMILES | O=C(Nc1ccc(F)cc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C12H5ClF11NO/c13-12(23,24)11(21,22)10(19,20)9(17,18)8(15,16)7(26)25-6-3-1-5(14)2-4-6/h1-4H,(H,25,26) |
| InChIKey | FQEZUMQCESNBPG-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.61 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|