C17H10ClF16NO — CID 4107079
9-chloro-N-(3,5-dimethylphenyl)-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanamide (PubChem CID 4107079) has the molecular formula C17H10ClF16NO and a molecular weight of 583.69 g/mol. Its IUPAC name is 9-chloro-N-(3,5-dimethylphenyl)-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanamide.
| Compound Name | 9-chloro-N-(3,5-dimethylphenyl)-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanamide |
|---|---|
| PubChem CID | 4107079 |
| Molecular Formula | C17H10ClF16NO |
| Molecular Weight | 583.69 g/mol |
| Exact Mass | 583.02 |
| IUPAC Name | 9-chloro-N-(3,5-dimethylphenyl)-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanamide |
| SMILES | Cc1cc(C)cc(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl)c1 |
| InChI | InChI=1S/C17H10ClF16NO/c1-6-3-7(2)5-8(4-6)35-9(36)10(19,20)11(21,22)12(23,24)13(25,26)14(27,28)15(29,30)16(31,32)17(18,33)34/h3-5H,1-2H3,(H,35,36) |
| InChIKey | LKGZCSVCBJJXMI-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.69 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|