C15H8ClF14NO2 — CID 4621112
8-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluoro-N-(3-methoxyphenyl)octanamide (PubChem CID 4621112) has the molecular formula C15H8ClF14NO2 and a molecular weight of 535.66 g/mol. Its IUPAC name is 8-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluoro-N-(3-methoxyphenyl)octanamide.
| Compound Name | 8-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluoro-N-(3-methoxyphenyl)octanamide |
|---|---|
| PubChem CID | 4621112 |
| Molecular Formula | C15H8ClF14NO2 |
| Molecular Weight | 535.66 g/mol |
| Exact Mass | 535.00 |
| IUPAC Name | 8-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluoro-N-(3-methoxyphenyl)octanamide |
| SMILES | COc1cccc(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl)c1 |
| InChI | InChI=1S/C15H8ClF14NO2/c1-33-7-4-2-3-6(5-7)31-8(32)9(17,18)10(19,20)11(21,22)12(23,24)13(25,26)14(27,28)15(16,29)30/h2-5H,1H3,(H,31,32) |
| InChIKey | OCRNAILWIRZTPP-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.66 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|