C12H9F8NO2 — CID 4521751
2,2,3,3,4,4,5,5-octafluoro-N-(3-methoxyphenyl)pentanamide (PubChem CID 4521751) has the molecular formula C12H9F8NO2 and a molecular weight of 351.19 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoro-N-(3-methoxyphenyl)pentanamide.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoro-N-(3-methoxyphenyl)pentanamide |
|---|---|
| PubChem CID | 4521751 |
| Molecular Formula | C12H9F8NO2 |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoro-N-(3-methoxyphenyl)pentanamide |
| SMILES | COc1cccc(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C12H9F8NO2/c1-23-7-4-2-3-6(5-7)21-9(22)11(17,18)12(19,20)10(15,16)8(13)14/h2-5,8H,1H3,(H,21,22) |
| InChIKey | YTJKLRZHLGRUHX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|