C17H8ClF16NO3 — CID 4611862
9-chloro-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanamide (PubChem CID 4611862) has the molecular formula C17H8ClF16NO3 and a molecular weight of 613.68 g/mol. Its IUPAC name is 9-chloro-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanamide.
| Compound Name | 9-chloro-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanamide |
|---|---|
| PubChem CID | 4611862 |
| Molecular Formula | C17H8ClF16NO3 |
| Molecular Weight | 613.68 g/mol |
| Exact Mass | 612.99 |
| IUPAC Name | 9-chloro-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanamide |
| SMILES | O=C(Nc1ccc2c(c1)OCCO2)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C17H8ClF16NO3/c18-17(33,34)16(31,32)15(29,30)14(27,28)13(25,26)12(23,24)11(21,22)10(19,20)9(36)35-6-1-2-7-8(5-6)38-4-3-37-7/h1-2,5H,3-4H2,(H,35,36) |
| InChIKey | UUULTZFJOCPLSE-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.68 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|