C18H12ClF16NO — CID 4172851
9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-N-(4-propan-2-ylphenyl)nonanamide (PubChem CID 4172851) has the molecular formula C18H12ClF16NO and a molecular weight of 597.72 g/mol. Its IUPAC name is 9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-N-(4-propan-2-ylphenyl)nonanamide.
| Compound Name | 9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-N-(4-propan-2-ylphenyl)nonanamide |
|---|---|
| PubChem CID | 4172851 |
| Molecular Formula | C18H12ClF16NO |
| Molecular Weight | 597.72 g/mol |
| Exact Mass | 597.04 |
| IUPAC Name | 9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-N-(4-propan-2-ylphenyl)nonanamide |
| SMILES | CC(C)c1ccc(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl)cc1 |
| InChI | InChI=1S/C18H12ClF16NO/c1-7(2)8-3-5-9(6-4-8)36-10(37)11(20,21)12(22,23)13(24,25)14(26,27)15(28,29)16(30,31)17(32,33)18(19,34)35/h3-7H,1-2H3,(H,36,37) |
| InChIKey | GEPOCKWCYYFPGK-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.72 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|