C18H8F12N2O2 — CID 3369312
N,N'-bis(3,4-difluorophenyl)-2,2,3,3,4,4,5,5-octafluorohexanediamide (PubChem CID 3369312) has the molecular formula C18H8F12N2O2 and a molecular weight of 512.25 g/mol. Its IUPAC name is N,N'-bis(3,4-difluorophenyl)-2,2,3,3,4,4,5,5-octafluorohexanediamide.
| Compound Name | N,N'-bis(3,4-difluorophenyl)-2,2,3,3,4,4,5,5-octafluorohexanediamide |
|---|---|
| PubChem CID | 3369312 |
| Molecular Formula | C18H8F12N2O2 |
| Molecular Weight | 512.25 g/mol |
| Exact Mass | 512.04 |
| IUPAC Name | N,N'-bis(3,4-difluorophenyl)-2,2,3,3,4,4,5,5-octafluorohexanediamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H8F12N2O2/c19-9-3-1-7(5-11(9)21)31-13(33)15(23,24)17(27,28)18(29,30)16(25,26)14(34)32-8-2-4-10(20)12(22)6-8/h1-6H,(H,31,33)(H,32,34) |
| InChIKey | MHBDITIJQNPEJS-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.25 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|