C11H5F11N2O — CID 71672999
1-(3,4-difluorophenyl)-3-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]urea (PubChem CID 71672999) has the molecular formula C11H5F11N2O and a molecular weight of 390.15 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]urea.
| Compound Name | 1-(3,4-difluorophenyl)-3-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]urea |
|---|---|
| PubChem CID | 71672999 |
| Molecular Formula | C11H5F11N2O |
| Molecular Weight | 390.15 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]urea |
| SMILES | O=C(Nc1ccc(F)c(F)c1)NC(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H5F11N2O/c12-5-2-1-4(3-6(5)13)23-7(25)24-8(9(14,15)16,10(17,18)19)11(20,21)22/h1-3H,(H2,23,24,25) |
| InChIKey | HXRCWULGQKSHBC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.15 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |