C17H12F8N2O — CID 71672898
1-(2-benzyl-1,1,1,3,3,3-hexafluoropropan-2-yl)-3-(3,4-difluorophenyl)urea (PubChem CID 71672898) has the molecular formula C17H12F8N2O and a molecular weight of 412.28 g/mol. Its IUPAC name is 1-(2-benzyl-1,1,1,3,3,3-hexafluoropropan-2-yl)-3-(3,4-difluorophenyl)urea.
| Compound Name | 1-(2-benzyl-1,1,1,3,3,3-hexafluoropropan-2-yl)-3-(3,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 71672898 |
| Molecular Formula | C17H12F8N2O |
| Molecular Weight | 412.28 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 1-(2-benzyl-1,1,1,3,3,3-hexafluoropropan-2-yl)-3-(3,4-difluorophenyl)urea |
| SMILES | O=C(Nc1ccc(F)c(F)c1)NC(Cc1ccccc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H12F8N2O/c18-12-7-6-11(8-13(12)19)26-14(28)27-15(16(20,21)22,17(23,24)25)9-10-4-2-1-3-5-10/h1-8H,9H2,(H2,26,27,28) |
| InChIKey | BXHIDYGRIVAQHD-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.28 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |