C14H6F13NO3 — CID 5171743
N-(1,3-benzodioxol-5-yl)-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanamide (PubChem CID 5171743) has the molecular formula C14H6F13NO3 and a molecular weight of 483.18 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanamide |
|---|---|
| PubChem CID | 5171743 |
| Molecular Formula | C14H6F13NO3 |
| Molecular Weight | 483.18 g/mol |
| Exact Mass | 483.01 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H6F13NO3/c15-9(16,8(29)28-5-1-2-6-7(3-5)31-4-30-6)10(17,18)11(19,20)12(21,22)13(23,24)14(25,26)27/h1-3H,4H2,(H,28,29) |
| InChIKey | ILQRUBKFPFGVMN-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.18 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|