C17H16FNO3 — CID 113197476
N-(1,3-benzodioxol-5-yl)-2-(4-fluorophenyl)-2-methylpropanamide (PubChem CID 113197476) has the molecular formula C17H16FNO3 and a molecular weight of 301.32 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-(4-fluorophenyl)-2-methylpropanamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-(4-fluorophenyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 113197476 |
| Molecular Formula | C17H16FNO3 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-(4-fluorophenyl)-2-methylpropanamide |
| SMILES | CC(C)(C(=O)Nc1ccc2c(c1)OCO2)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H16FNO3/c1-17(2,11-3-5-12(18)6-4-11)16(20)19-13-7-8-14-15(9-13)22-10-21-14/h3-9H,10H2,1-2H3,(H,19,20) |
| InChIKey | HNHNACCKCPALFA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |