C15H6ClF14NO3 — CID 4639450
N-(1,3-benzodioxol-5-yl)-8-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluorooctanamide (PubChem CID 4639450) has the molecular formula C15H6ClF14NO3 and a molecular weight of 549.64 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-8-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluorooctanamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-8-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluorooctanamide |
|---|---|
| PubChem CID | 4639450 |
| Molecular Formula | C15H6ClF14NO3 |
| Molecular Weight | 549.64 g/mol |
| Exact Mass | 548.98 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-8-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluorooctanamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C15H6ClF14NO3/c16-15(29,30)14(27,28)13(25,26)12(23,24)11(21,22)10(19,20)9(17,18)8(32)31-5-1-2-6-7(3-5)34-4-33-6/h1-3H,4H2,(H,31,32) |
| InChIKey | JWCKPOXFYCZVPK-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.64 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|