C11H9F4NO3 — CID 103731825
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,2,3,3-tetrafluoropropanamide (PubChem CID 103731825) has the molecular formula C11H9F4NO3 and a molecular weight of 279.19 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103731825 |
| Molecular Formula | C11H9F4NO3 |
| Molecular Weight | 279.19 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,2,3,3-tetrafluoropropanamide |
| SMILES | O=C(Nc1ccc2c(c1)OCCO2)C(F)(F)C(F)F |
| InChI | InChI=1S/C11H9F4NO3/c12-9(13)11(14,15)10(17)16-6-1-2-7-8(5-6)19-4-3-18-7/h1-2,5,9H,3-4H2,(H,16,17) |
| InChIKey | ODRFJFGKUVGIEC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.19 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|