C9H6ClF4NO2 — CID 113368357
N-(3-chloro-4-hydroxyphenyl)-2,2,3,3-tetrafluoropropanamide (PubChem CID 113368357) has the molecular formula C9H6ClF4NO2 and a molecular weight of 271.60 g/mol. Its IUPAC name is N-(3-chloro-4-hydroxyphenyl)-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-(3-chloro-4-hydroxyphenyl)-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 113368357 |
| Molecular Formula | C9H6ClF4NO2 |
| Molecular Weight | 271.60 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | N-(3-chloro-4-hydroxyphenyl)-2,2,3,3-tetrafluoropropanamide |
| SMILES | O=C(Nc1ccc(O)c(Cl)c1)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H6ClF4NO2/c10-5-3-4(1-2-6(5)16)15-8(17)9(13,14)7(11)12/h1-3,7,16H,(H,15,17) |
| InChIKey | ZQHRSILGZUMJHN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.60 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|