C11H8F4N2O — CID 103732445
2,2,3,3-tetrafluoro-N-(1H-indol-5-yl)propanamide (PubChem CID 103732445) has the molecular formula C11H8F4N2O and a molecular weight of 260.19 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-(1H-indol-5-yl)propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-(1H-indol-5-yl)propanamide |
|---|---|
| PubChem CID | 103732445 |
| Molecular Formula | C11H8F4N2O |
| Molecular Weight | 260.19 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-(1H-indol-5-yl)propanamide |
| SMILES | O=C(Nc1ccc2[nH]ccc2c1)C(F)(F)C(F)F |
| InChI | InChI=1S/C11H8F4N2O/c12-9(13)11(14,15)10(18)17-7-1-2-8-6(5-7)3-4-16-8/h1-5,9,16H,(H,17,18) |
| InChIKey | RCCSZCQHYNROKS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.19 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|