C17H15F2N3OS — CID 155742454
1-[3-(1,1-difluoroethylsulfanyl)phenyl]-3-(1H-indol-5-yl)urea (PubChem CID 155742454) has the molecular formula C17H15F2N3OS and a molecular weight of 347.39 g/mol. Its IUPAC name is 1-[3-(1,1-difluoroethylsulfanyl)phenyl]-3-(1H-indol-5-yl)urea.
| Compound Name | 1-[3-(1,1-difluoroethylsulfanyl)phenyl]-3-(1H-indol-5-yl)urea |
|---|---|
| PubChem CID | 155742454 |
| Molecular Formula | C17H15F2N3OS |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 1-[3-(1,1-difluoroethylsulfanyl)phenyl]-3-(1H-indol-5-yl)urea |
| SMILES | CC(F)(F)Sc1cccc(NC(=O)Nc2ccc3[nH]ccc3c2)c1 |
| InChI | InChI=1S/C17H15F2N3OS/c1-17(18,19)24-14-4-2-3-12(10-14)21-16(23)22-13-5-6-15-11(9-13)7-8-20-15/h2-10,20H,1H3,(H2,21,22,23) |
| InChIKey | CWIIIEXWDUTGMR-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |