C19H18F3N3O — CID 155746688
1-(1H-indol-5-yl)-3-[1-[3-(trifluoromethyl)phenyl]propan-2-yl]urea (PubChem CID 155746688) has the molecular formula C19H18F3N3O and a molecular weight of 361.37 g/mol. Its IUPAC name is 1-(1H-indol-5-yl)-3-[1-[3-(trifluoromethyl)phenyl]propan-2-yl]urea.
| Compound Name | 1-(1H-indol-5-yl)-3-[1-[3-(trifluoromethyl)phenyl]propan-2-yl]urea |
|---|---|
| PubChem CID | 155746688 |
| Molecular Formula | C19H18F3N3O |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 1-(1H-indol-5-yl)-3-[1-[3-(trifluoromethyl)phenyl]propan-2-yl]urea |
| SMILES | CC(Cc1cccc(C(F)(F)F)c1)NC(=O)Nc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C19H18F3N3O/c1-12(9-13-3-2-4-15(10-13)19(20,21)22)24-18(26)25-16-5-6-17-14(11-16)7-8-23-17/h2-8,10-12,23H,9H2,1H3,(H2,24,25,26) |
| InChIKey | QQAJXUDALDHQGH-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |