C19H13F6N3O — CID 121264541
1-[(E)-2-[2,5-bis(trifluoromethyl)phenyl]ethenyl]-3-(1H-indol-5-yl)urea (PubChem CID 121264541) has the molecular formula C19H13F6N3O and a molecular weight of 413.32 g/mol. Its IUPAC name is 1-[(E)-2-[2,5-bis(trifluoromethyl)phenyl]ethenyl]-3-(1H-indol-5-yl)urea.
| Compound Name | 1-[(E)-2-[2,5-bis(trifluoromethyl)phenyl]ethenyl]-3-(1H-indol-5-yl)urea |
|---|---|
| PubChem CID | 121264541 |
| Molecular Formula | C19H13F6N3O |
| Molecular Weight | 413.32 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 1-[(E)-2-[2,5-bis(trifluoromethyl)phenyl]ethenyl]-3-(1H-indol-5-yl)urea |
| SMILES | O=C(N/C=C/c1cc(C(F)(F)F)ccc1C(F)(F)F)Nc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C19H13F6N3O/c20-18(21,22)13-1-3-15(19(23,24)25)11(9-13)5-8-27-17(29)28-14-2-4-16-12(10-14)6-7-26-16/h1-10,26H,(H2,27,28,29)/b8-5+ |
| InChIKey | XIDMMGVQDYKROS-VMPITWQZSA-N |
| XLogP | 6.00 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.32 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |