C19H14F3NO2 — CID 90363615
1-(1H-indol-5-yl)-4-[4-(trifluoromethyl)phenyl]butane-1,4-dione (PubChem CID 90363615) has the molecular formula C19H14F3NO2 and a molecular weight of 345.32 g/mol. Its IUPAC name is 1-(1H-indol-5-yl)-4-[4-(trifluoromethyl)phenyl]butane-1,4-dione.
| Compound Name | 1-(1H-indol-5-yl)-4-[4-(trifluoromethyl)phenyl]butane-1,4-dione |
|---|---|
| PubChem CID | 90363615 |
| Molecular Formula | C19H14F3NO2 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 1-(1H-indol-5-yl)-4-[4-(trifluoromethyl)phenyl]butane-1,4-dione |
| SMILES | O=C(CCC(=O)c1ccc2[nH]ccc2c1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H14F3NO2/c20-19(21,22)15-4-1-12(2-5-15)17(24)7-8-18(25)14-3-6-16-13(11-14)9-10-23-16/h1-6,9-11,23H,7-8H2 |
| InChIKey | RUYVPQQAEGGYEJ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |