C16H12BrF3N2O — CID 108905244
1-[(E)-2-(2-bromophenyl)ethenyl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 108905244) has the molecular formula C16H12BrF3N2O and a molecular weight of 385.18 g/mol. Its IUPAC name is 1-[(E)-2-(2-bromophenyl)ethenyl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(E)-2-(2-bromophenyl)ethenyl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 108905244 |
| Molecular Formula | C16H12BrF3N2O |
| Molecular Weight | 385.18 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | 1-[(E)-2-(2-bromophenyl)ethenyl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(N/C=C/c1ccccc1Br)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H12BrF3N2O/c17-14-4-2-1-3-11(14)9-10-21-15(23)22-13-7-5-12(6-8-13)16(18,19)20/h1-10H,(H2,21,22,23)/b10-9+ |
| InChIKey | XRXGXSCXJFHSMO-MDZDMXLPSA-N |
| XLogP | 5.26 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.18 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |