About 1-bromo-2-[(1Z,5Z)-6-[4-(trifluoromethyl)phenyl]hexa-1,5-dien-3-ynyl]benzene
1-bromo-2-[(1Z,5Z)-6-[4-(trifluoromethyl)phenyl]hexa-1,5-dien-3-ynyl]benzene (PubChem CID 11394778) has the molecular formula C19H12BrF3
and a molecular weight of 377.20 g/mol. Its IUPAC name is 1-bromo-2-[(1Z,5Z)-6-[4-(trifluoromethyl)phenyl]hexa-1,5-dien-3-ynyl]benzene.
Molecular Properties
| Compound Name | 1-bromo-2-[(1Z,5Z)-6-[4-(trifluoromethyl)phenyl]hexa-1,5-dien-3-ynyl]benzene |
| PubChem CID | 11394778 |
| Molecular Formula | C19H12BrF3 |
| Molecular Weight | 377.20 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | 1-bromo-2-[(1Z,5Z)-6-[4-(trifluoromethyl)phenyl]hexa-1,5-dien-3-ynyl]benzene |
| SMILES | FC(F)(F)c1ccc(/C=C\C#C/C=C\c2ccccc2Br)cc1 |
| InChI | InChI=1S/C19H12BrF3/c20-18-10-6-5-9-16(18)8-4-2-1-3-7-15-11-13-17(14-12-15)19(21,22)23/h3-14H/b7-3-,8-4- |
| InChIKey | UTVWVNLFVPPAPU-VHOZIDCHSA-N |
| XLogP | 6.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.20 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2-[(1Z,5Z)-6-[4-(trifluoromethyl)phenyl]hexa-1,5-dien-3-ynyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-[(1Z,5Z)-6-[4-(trifluoromethyl)phenyl]hexa-1,5-dien-3-ynyl]benzene?
The IUPAC name of 1-bromo-2-[(1Z,5Z)-6-[4-(trifluoromethyl)phenyl]hexa-1,5-dien-3-ynyl]benzene (CID 11394778) is 1-bromo-2-[(1Z,5Z)-6-[4-(trifluoromethyl)phenyl]hexa-1,5-dien-3-ynyl]benzene.
What is the SMILES notation for 1-bromo-2-[(1Z,5Z)-6-[4-(trifluoromethyl)phenyl]hexa-1,5-dien-3-ynyl]benzene?
The canonical SMILES for 1-bromo-2-[(1Z,5Z)-6-[4-(trifluoromethyl)phenyl]hexa-1,5-dien-3-ynyl]benzene is FC(F)(F)c1ccc(/C=C\C#C/C=C\c2ccccc2Br)cc1.
What is the InChIKey of 1-bromo-2-[(1Z,5Z)-6-[4-(trifluoromethyl)phenyl]hexa-1,5-dien-3-ynyl]benzene?
The InChIKey is UTVWVNLFVPPAPU-VHOZIDCHSA-N. The full InChI is InChI=1S/C19H12BrF3/c20-18-10-6-5-9-16(18)8-4-2-1-3-7-15-11-13-17(14-12-15)19(21,22)23/h3-14H/b7-3-,8-4-.
What are the key properties of 1-bromo-2-[(1Z,5Z)-6-[4-(trifluoromethyl)phenyl]hexa-1,5-dien-3-ynyl]benzene?
1-bromo-2-[(1Z,5Z)-6-[4-(trifluoromethyl)phenyl]hexa-1,5-dien-3-ynyl]benzene has a molecular weight of 377.20 g/mol, XLogP of 6.20, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-[(1Z,5Z)-6-[4-(trifluoromethyl)phenyl]hexa-1,5-dien-3-ynyl]benzene is sourced from PubChem (CID 11394778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).