C19H12BrF3 — CID 11394778
1-bromo-2-[(1Z,5Z)-6-[4-(trifluoromethyl)phenyl]hexa-1,5-dien-3-ynyl]benzene (PubChem CID 11394778) has the molecular formula C19H12BrF3 and a molecular weight of 377.20 g/mol. Its IUPAC name is 1-bromo-2-[(1Z,5Z)-6-[4-(trifluoromethyl)phenyl]hexa-1,5-dien-3-ynyl]benzene.
| Compound Name | 1-bromo-2-[(1Z,5Z)-6-[4-(trifluoromethyl)phenyl]hexa-1,5-dien-3-ynyl]benzene |
|---|---|
| PubChem CID | 11394778 |
| Molecular Formula | C19H12BrF3 |
| Molecular Weight | 377.20 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | 1-bromo-2-[(1Z,5Z)-6-[4-(trifluoromethyl)phenyl]hexa-1,5-dien-3-ynyl]benzene |
| SMILES | FC(F)(F)c1ccc(/C=C\C#C/C=C\c2ccccc2Br)cc1 |
| InChI | InChI=1S/C19H12BrF3/c20-18-10-6-5-9-16(18)8-4-2-1-3-7-15-11-13-17(14-12-15)19(21,22)23/h3-14H/b7-3-,8-4- |
| InChIKey | UTVWVNLFVPPAPU-VHOZIDCHSA-N |
| XLogP | 6.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.20 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|