C18H14 — CID 102243742
[(1Z,5Z)-6-phenylhexa-1,5-dien-3-ynyl]benzene (PubChem CID 102243742) has the molecular formula C18H14 and a molecular weight of 230.31 g/mol. Its IUPAC name is [(1Z,5Z)-6-phenylhexa-1,5-dien-3-ynyl]benzene.
| Compound Name | [(1Z,5Z)-6-phenylhexa-1,5-dien-3-ynyl]benzene |
|---|---|
| PubChem CID | 102243742 |
| Molecular Formula | C18H14 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | [(1Z,5Z)-6-phenylhexa-1,5-dien-3-ynyl]benzene |
| SMILES | C(#C/C=C\c1ccccc1)/C=C\c1ccccc1 |
| InChI | InChI=1S/C18H14/c1(5-11-17-13-7-3-8-14-17)2-6-12-18-15-9-4-10-16-18/h3-16H/b11-5-,12-6- |
| InChIKey | SZGYWVJLKRPART-CBIKUMSCSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|