About disodium;hydride;(E)-stilbene
disodium;hydride;(E)-stilbene (PubChem CID 173089328) has the molecular formula C14H14Na2
and a molecular weight of 228.25 g/mol. Its IUPAC name is disodium;hydride;(E)-stilbene.
Molecular Properties
| Compound Name | disodium;hydride;(E)-stilbene |
| PubChem CID | 173089328 |
| Molecular Formula | C14H14Na2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | disodium;hydride;(E)-stilbene |
| SMILES | C(=C/c1ccccc1)\c1ccccc1.[H-].[H-].[Na+].[Na+] |
| InChI | InChI=1S/C14H12.2Na.2H/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;;;;/h1-12H;;;;/q;2*+1;2*-1/b12-11+;;;; |
| InChIKey | QKDYMTILMSNWQY-MOSUJMLHSA-N |
| XLogP | -1.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze disodium;hydride;(E)-stilbene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;hydride;(E)-stilbene?
The IUPAC name of disodium;hydride;(E)-stilbene (CID 173089328) is disodium;hydride;(E)-stilbene.
What is the SMILES notation for disodium;hydride;(E)-stilbene?
The canonical SMILES for disodium;hydride;(E)-stilbene is C(=C/c1ccccc1)\c1ccccc1.[H-].[H-].[Na+].[Na+].
What is the InChIKey of disodium;hydride;(E)-stilbene?
The InChIKey is QKDYMTILMSNWQY-MOSUJMLHSA-N. The full InChI is InChI=1S/C14H12.2Na.2H/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;;;;/h1-12H;;;;/q;2*+1;2*-1/b12-11+;;;;.
What are the key properties of disodium;hydride;(E)-stilbene?
disodium;hydride;(E)-stilbene has a molecular weight of 228.25 g/mol, XLogP of -1.91, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;hydride;(E)-stilbene is sourced from PubChem (CID 173089328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).