About bis(1,2-bis[(E)-2-phenylethenyl]benzene);sulfane
bis(1,2-bis[(E)-2-phenylethenyl]benzene);sulfane (PubChem CID 68618408) has the molecular formula C44H38S
and a molecular weight of 598.86 g/mol. Its IUPAC name is bis(1,2-bis[(E)-2-phenylethenyl]benzene);sulfane.
Molecular Properties
| Compound Name | bis(1,2-bis[(E)-2-phenylethenyl]benzene);sulfane |
| PubChem CID | 68618408 |
| Molecular Formula | C44H38S |
| Molecular Weight | 598.86 g/mol |
| Exact Mass | 598.27 |
| IUPAC Name | bis(1,2-bis[(E)-2-phenylethenyl]benzene);sulfane |
| SMILES | C(=C/c1ccccc1/C=C/c1ccccc1)\c1ccccc1.C(=C/c1ccccc1/C=C/c1ccccc1)\c1ccccc1.S |
| InChI | InChI=1S/2C22H18.H2S/c2*1-3-9-19(10-4-1)15-17-21-13-7-8-14-22(21)18-16-20-11-5-2-6-12-20;/h2*1-18H;1H2/b2*17-15+,18-16+; |
| InChIKey | PQJCFMWQGCGTJB-OTJFKLSVSA-N |
| XLogP | 12.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 598.86 |
| LogP ≤ 5 | 12.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze bis(1,2-bis[(E)-2-phenylethenyl]benzene);sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1,2-bis[(E)-2-phenylethenyl]benzene);sulfane?
The IUPAC name of bis(1,2-bis[(E)-2-phenylethenyl]benzene);sulfane (CID 68618408) is bis(1,2-bis[(E)-2-phenylethenyl]benzene);sulfane.
What is the SMILES notation for bis(1,2-bis[(E)-2-phenylethenyl]benzene);sulfane?
The canonical SMILES for bis(1,2-bis[(E)-2-phenylethenyl]benzene);sulfane is C(=C/c1ccccc1/C=C/c1ccccc1)\c1ccccc1.C(=C/c1ccccc1/C=C/c1ccccc1)\c1ccccc1.S.
What is the InChIKey of bis(1,2-bis[(E)-2-phenylethenyl]benzene);sulfane?
The InChIKey is PQJCFMWQGCGTJB-OTJFKLSVSA-N. The full InChI is InChI=1S/2C22H18.H2S/c2*1-3-9-19(10-4-1)15-17-21-13-7-8-14-22(21)18-16-20-11-5-2-6-12-20;/h2*1-18H;1H2/b2*17-15+,18-16+;.
What are the key properties of bis(1,2-bis[(E)-2-phenylethenyl]benzene);sulfane?
bis(1,2-bis[(E)-2-phenylethenyl]benzene);sulfane has a molecular weight of 598.86 g/mol, XLogP of 12.17, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1,2-bis[(E)-2-phenylethenyl]benzene);sulfane is sourced from PubChem (CID 68618408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).