About hydride;rubidium(1+);stilbene
hydride;rubidium(1+);stilbene (PubChem CID 173437843) has the molecular formula C14H13Rb
and a molecular weight of 266.73 g/mol. Its IUPAC name is hydride;rubidium(1+);stilbene.
Molecular Properties
| Compound Name | hydride;rubidium(1+);stilbene |
| PubChem CID | 173437843 |
| Molecular Formula | C14H13Rb |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | hydride;rubidium(1+);stilbene |
| SMILES | C(=Cc1ccccc1)c1ccccc1.[H-].[Rb+] |
| InChI | InChI=1S/C14H12.Rb.H/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;;/h1-12H;;/q;+1;-1 |
| InChIKey | RMGISKLFWAEQFX-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze hydride;rubidium(1+);stilbene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydride;rubidium(1+);stilbene?
The IUPAC name of hydride;rubidium(1+);stilbene (CID 173437843) is hydride;rubidium(1+);stilbene.
What is the SMILES notation for hydride;rubidium(1+);stilbene?
The canonical SMILES for hydride;rubidium(1+);stilbene is C(=Cc1ccccc1)c1ccccc1.[H-].[Rb+].
What is the InChIKey of hydride;rubidium(1+);stilbene?
The InChIKey is RMGISKLFWAEQFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12.Rb.H/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;;/h1-12H;;/q;+1;-1.
What are the key properties of hydride;rubidium(1+);stilbene?
hydride;rubidium(1+);stilbene has a molecular weight of 266.73 g/mol, XLogP of 0.97, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hydride;rubidium(1+);stilbene is sourced from PubChem (CID 173437843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).