About N,N-dimethylmethanamine;stilbene
N,N-dimethylmethanamine;stilbene (PubChem CID 174368184) has the molecular formula C17H21N
and a molecular weight of 239.36 g/mol. Its IUPAC name is N,N-dimethylmethanamine;stilbene.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;stilbene |
| PubChem CID | 174368184 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | N,N-dimethylmethanamine;stilbene |
| SMILES | C(=Cc1ccccc1)c1ccccc1.CN(C)C |
| InChI | InChI=1S/C14H12.C3H9N/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;1-4(2)3/h1-12H;1-3H3 |
| InChIKey | WRCFZRVVTFNKDO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylmethanamine;stilbene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;stilbene?
The IUPAC name of N,N-dimethylmethanamine;stilbene (CID 174368184) is N,N-dimethylmethanamine;stilbene.
What is the SMILES notation for N,N-dimethylmethanamine;stilbene?
The canonical SMILES for N,N-dimethylmethanamine;stilbene is C(=Cc1ccccc1)c1ccccc1.CN(C)C.
What is the InChIKey of N,N-dimethylmethanamine;stilbene?
The InChIKey is WRCFZRVVTFNKDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12.C3H9N/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;1-4(2)3/h1-12H;1-3H3.
What are the key properties of N,N-dimethylmethanamine;stilbene?
N,N-dimethylmethanamine;stilbene has a molecular weight of 239.36 g/mol, XLogP of 4.03, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;stilbene is sourced from PubChem (CID 174368184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).