C12H9NO2 — CID 102228268
[(1E,5E)-6-nitrohexa-1,5-dien-3-ynyl]benzene (PubChem CID 102228268) has the molecular formula C12H9NO2 and a molecular weight of 199.21 g/mol. Its IUPAC name is [(1E,5E)-6-nitrohexa-1,5-dien-3-ynyl]benzene.
| Compound Name | [(1E,5E)-6-nitrohexa-1,5-dien-3-ynyl]benzene |
|---|---|
| PubChem CID | 102228268 |
| Molecular Formula | C12H9NO2 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | [(1E,5E)-6-nitrohexa-1,5-dien-3-ynyl]benzene |
| SMILES | O=[N+]([O-])/C=C/C#C/C=C/c1ccccc1 |
| InChI | InChI=1S/C12H9NO2/c14-13(15)11-7-2-1-4-8-12-9-5-3-6-10-12/h3-11H/b8-4+,11-7+ |
| InChIKey | BWLSOCQZKNPTQD-RIALUSDFSA-N |
| XLogP | 2.49 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|