About 2-nitroethenylbenzene
2-nitroethenylbenzene (PubChem CID 7626) has the molecular formula C8H7NO2
and a molecular weight of 149.15 g/mol. Its IUPAC name is 2-nitroethenylbenzene.
Molecular Properties
| Compound Name | 2-nitroethenylbenzene |
| PubChem CID | 7626 |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | 2-nitroethenylbenzene |
| SMILES | O=[N+]([O-])C=Cc1ccccc1 |
| InChI | InChI=1S/C8H7NO2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H |
| InChIKey | PIAOLBVUVDXHHL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitroethenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitroethenylbenzene?
The IUPAC name of 2-nitroethenylbenzene (CID 7626) is 2-nitroethenylbenzene.
What is the SMILES notation for 2-nitroethenylbenzene?
The canonical SMILES for 2-nitroethenylbenzene is O=[N+]([O-])C=Cc1ccccc1.
What is the InChIKey of 2-nitroethenylbenzene?
The InChIKey is PIAOLBVUVDXHHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H.
What are the key properties of 2-nitroethenylbenzene?
2-nitroethenylbenzene has a molecular weight of 149.15 g/mol, XLogP of 1.93, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitroethenylbenzene is sourced from PubChem (CID 7626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).