About 2-nitroethenylbenzene;2-phenylethenyl acetate
2-nitroethenylbenzene;2-phenylethenyl acetate (PubChem CID 157123844) has the molecular formula C18H17NO4
and a molecular weight of 311.34 g/mol. Its IUPAC name is 2-nitroethenylbenzene;2-phenylethenyl acetate.
Molecular Properties
| Compound Name | 2-nitroethenylbenzene;2-phenylethenyl acetate |
| PubChem CID | 157123844 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 2-nitroethenylbenzene;2-phenylethenyl acetate |
| SMILES | CC(=O)OC=Cc1ccccc1.O=[N+]([O-])C=Cc1ccccc1 |
| InChI | InChI=1S/C10H10O2.C8H7NO2/c1-9(11)12-8-7-10-5-3-2-4-6-10;10-9(11)7-6-8-4-2-1-3-5-8/h2-8H,1H3;1-7H |
| InChIKey | AIHCWLVVASSAHZ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitroethenylbenzene;2-phenylethenyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitroethenylbenzene;2-phenylethenyl acetate?
The IUPAC name of 2-nitroethenylbenzene;2-phenylethenyl acetate (CID 157123844) is 2-nitroethenylbenzene;2-phenylethenyl acetate.
What is the SMILES notation for 2-nitroethenylbenzene;2-phenylethenyl acetate?
The canonical SMILES for 2-nitroethenylbenzene;2-phenylethenyl acetate is CC(=O)OC=Cc1ccccc1.O=[N+]([O-])C=Cc1ccccc1.
What is the InChIKey of 2-nitroethenylbenzene;2-phenylethenyl acetate?
The InChIKey is AIHCWLVVASSAHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2.C8H7NO2/c1-9(11)12-8-7-10-5-3-2-4-6-10;10-9(11)7-6-8-4-2-1-3-5-8/h2-8H,1H3;1-7H.
What are the key properties of 2-nitroethenylbenzene;2-phenylethenyl acetate?
2-nitroethenylbenzene;2-phenylethenyl acetate has a molecular weight of 311.34 g/mol, XLogP of 4.15, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitroethenylbenzene;2-phenylethenyl acetate is sourced from PubChem (CID 157123844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).