About 2-phenylethenyl 3-amino-2-methylbut-2-enoate
2-phenylethenyl 3-amino-2-methylbut-2-enoate (PubChem CID 175322238) has the molecular formula C13H15NO2
and a molecular weight of 217.27 g/mol. Its IUPAC name is 2-phenylethenyl 3-amino-2-methylbut-2-enoate.
Molecular Properties
| Compound Name | 2-phenylethenyl 3-amino-2-methylbut-2-enoate |
| PubChem CID | 175322238 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 2-phenylethenyl 3-amino-2-methylbut-2-enoate |
| SMILES | CC(N)=C(C)C(=O)OC=Cc1ccccc1 |
| InChI | InChI=1S/C13H15NO2/c1-10(11(2)14)13(15)16-9-8-12-6-4-3-5-7-12/h3-9H,14H2,1-2H3 |
| InChIKey | CEIMKVXJCUAIAT-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylethenyl 3-amino-2-methylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethenyl 3-amino-2-methylbut-2-enoate?
The IUPAC name of 2-phenylethenyl 3-amino-2-methylbut-2-enoate (CID 175322238) is 2-phenylethenyl 3-amino-2-methylbut-2-enoate.
What is the SMILES notation for 2-phenylethenyl 3-amino-2-methylbut-2-enoate?
The canonical SMILES for 2-phenylethenyl 3-amino-2-methylbut-2-enoate is CC(N)=C(C)C(=O)OC=Cc1ccccc1.
What is the InChIKey of 2-phenylethenyl 3-amino-2-methylbut-2-enoate?
The InChIKey is CEIMKVXJCUAIAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO2/c1-10(11(2)14)13(15)16-9-8-12-6-4-3-5-7-12/h3-9H,14H2,1-2H3.
What are the key properties of 2-phenylethenyl 3-amino-2-methylbut-2-enoate?
2-phenylethenyl 3-amino-2-methylbut-2-enoate has a molecular weight of 217.27 g/mol, XLogP of 2.45, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethenyl 3-amino-2-methylbut-2-enoate is sourced from PubChem (CID 175322238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).