C17H22O2 — CID 174057305
tert-butyl 2,3-dimethyl-5-phenylpenta-2,4-dienoate (PubChem CID 174057305) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is tert-butyl 2,3-dimethyl-5-phenylpenta-2,4-dienoate.
| Compound Name | tert-butyl 2,3-dimethyl-5-phenylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 174057305 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | tert-butyl 2,3-dimethyl-5-phenylpenta-2,4-dienoate |
| SMILES | CC(C=Cc1ccccc1)=C(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H22O2/c1-13(11-12-15-9-7-6-8-10-15)14(2)16(18)19-17(3,4)5/h6-12H,1-5H3 |
| InChIKey | FECCIJCPCNUFKA-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|