tert-butyl 2,3-dimethyl-5-phenylpenta-2,4-dienoate

C17H22O2 — CID 174057305

IUPACtert-butyl 2,3-dimethyl-5-phenylpenta-2,4-dienoate
SMILESCC(C=Cc1ccccc1)=C(C)C(=O)OC(C)(C)C
InChIInChI=1S/C17H22O2/c1-13(11-12-15-9-7-6-8-10-15)14(2)16(18)19-17(3,4)5/h6-12H,1-5H3
InChIKeyFECCIJCPCNUFKA-UHFFFAOYSA-N
MW258.36 g/mol
LogP4.38
Rot. Bonds3

About tert-butyl 2,3-dimethyl-5-phenylpenta-2,4-dienoate

tert-butyl 2,3-dimethyl-5-phenylpenta-2,4-dienoate (PubChem CID 174057305) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is tert-butyl 2,3-dimethyl-5-phenylpenta-2,4-dienoate.

Molecular Properties

Compound Nametert-butyl 2,3-dimethyl-5-phenylpenta-2,4-dienoate
PubChem CID174057305
Molecular FormulaC17H22O2
Molecular Weight258.36 g/mol
Exact Mass258.16
IUPAC Nametert-butyl 2,3-dimethyl-5-phenylpenta-2,4-dienoate
SMILESCC(C=Cc1ccccc1)=C(C)C(=O)OC(C)(C)C
InChIInChI=1S/C17H22O2/c1-13(11-12-15-9-7-6-8-10-15)14(2)16(18)19-17(3,4)5/h6-12H,1-5H3
InChIKeyFECCIJCPCNUFKA-UHFFFAOYSA-N
XLogP4.38
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.36
LogP ≤ 54.38
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze tert-butyl 2,3-dimethyl-5-phenylpenta-2,4-dienoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butyl 2,3-dimethyl-5-phenylpenta-2,4-dienoate?
The IUPAC name of tert-butyl 2,3-dimethyl-5-phenylpenta-2,4-dienoate (CID 174057305) is tert-butyl 2,3-dimethyl-5-phenylpenta-2,4-dienoate.
What is the SMILES notation for tert-butyl 2,3-dimethyl-5-phenylpenta-2,4-dienoate?
The canonical SMILES for tert-butyl 2,3-dimethyl-5-phenylpenta-2,4-dienoate is CC(C=Cc1ccccc1)=C(C)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2,3-dimethyl-5-phenylpenta-2,4-dienoate?
The InChIKey is FECCIJCPCNUFKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22O2/c1-13(11-12-15-9-7-6-8-10-15)14(2)16(18)19-17(3,4)5/h6-12H,1-5H3.
What are the key properties of tert-butyl 2,3-dimethyl-5-phenylpenta-2,4-dienoate?
tert-butyl 2,3-dimethyl-5-phenylpenta-2,4-dienoate has a molecular weight of 258.36 g/mol, XLogP of 4.38, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2,3-dimethyl-5-phenylpenta-2,4-dienoate is sourced from PubChem (CID 174057305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).