C18H20O4 — CID 100934564
dimethyl (E)-2-[(2E,4Z)-3-methyl-5-phenylpenta-2,4-dien-2-yl]but-2-enedioate (PubChem CID 100934564) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is dimethyl (E)-2-[(2E,4Z)-3-methyl-5-phenylpenta-2,4-dien-2-yl]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[(2E,4Z)-3-methyl-5-phenylpenta-2,4-dien-2-yl]but-2-enedioate |
|---|---|
| PubChem CID | 100934564 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | dimethyl (E)-2-[(2E,4Z)-3-methyl-5-phenylpenta-2,4-dien-2-yl]but-2-enedioate |
| SMILES | COC(=O)/C=C(C(=O)OC)\C(C)=C(C)\C=C/c1ccccc1 |
| InChI | InChI=1S/C18H20O4/c1-13(10-11-15-8-6-5-7-9-15)14(2)16(18(20)22-4)12-17(19)21-3/h5-12H,1-4H3/b11-10-,14-13+,16-12+ |
| InChIKey | JIPHJNPHCIYBSR-ZGTYXHIESA-N |
| XLogP | 3.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|