C20H20O6 — CID 19966781
dimethyl benzene-1,2-dicarboxylate;methyl (E)-3-phenylprop-2-enoate (PubChem CID 19966781) has the molecular formula C20H20O6 and a molecular weight of 356.37 g/mol. Its IUPAC name is dimethyl benzene-1,2-dicarboxylate;methyl (E)-3-phenylprop-2-enoate.
| Compound Name | dimethyl benzene-1,2-dicarboxylate;methyl (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 19966781 |
| Molecular Formula | C20H20O6 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | dimethyl benzene-1,2-dicarboxylate;methyl (E)-3-phenylprop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccccc1.COC(=O)c1ccccc1C(=O)OC |
| InChI | InChI=1S/C10H10O4.C10H10O2/c1-13-9(11)7-5-3-4-6-8(7)10(12)14-2;1-12-10(11)8-7-9-5-3-2-4-6-9/h3-6H,1-2H3;2-8H,1H3/b;8-7+ |
| InChIKey | JZQRYHJQXVXSNT-ILHSMLOTSA-N |
| XLogP | 3.13 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|