C30H36N2O6 — CID 67780532
butyl 2-aminobenzoate;ethyl 2-aminobenzoate;methyl 3-phenylprop-2-enoate (PubChem CID 67780532) has the molecular formula C30H36N2O6 and a molecular weight of 520.63 g/mol. Its IUPAC name is butyl 2-aminobenzoate;ethyl 2-aminobenzoate;methyl 3-phenylprop-2-enoate.
| Compound Name | butyl 2-aminobenzoate;ethyl 2-aminobenzoate;methyl 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 67780532 |
| Molecular Formula | C30H36N2O6 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | butyl 2-aminobenzoate;ethyl 2-aminobenzoate;methyl 3-phenylprop-2-enoate |
| SMILES | CCCCOC(=O)c1ccccc1N.CCOC(=O)c1ccccc1N.COC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C11H15NO2.C10H10O2.C9H11NO2/c1-2-3-8-14-11(13)9-6-4-5-7-10(9)12;1-12-10(11)8-7-9-5-3-2-4-6-9;1-2-12-9(11)7-5-3-4-6-8(7)10/h4-7H,2-3,8,12H2,1H3;2-8H,1H3;3-6H,2,10H2,1H3 |
| InChIKey | LARSOHNENRGKOE-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 130.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|