C20H21NO6 — CID 6277559
diethyl 2-amino-6-[(E)-3-methoxy-3-oxoprop-1-enyl]azulene-1,3-dicarboxylate (PubChem CID 6277559) has the molecular formula C20H21NO6 and a molecular weight of 371.39 g/mol. Its IUPAC name is diethyl 2-amino-6-[(E)-3-methoxy-3-oxoprop-1-enyl]azulene-1,3-dicarboxylate.
| Compound Name | diethyl 2-amino-6-[(E)-3-methoxy-3-oxoprop-1-enyl]azulene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 6277559 |
| Molecular Formula | C20H21NO6 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | diethyl 2-amino-6-[(E)-3-methoxy-3-oxoprop-1-enyl]azulene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1c2ccc(/C=C/C(=O)OC)ccc-2c(C(=O)OCC)c1N |
| InChI | InChI=1S/C20H21NO6/c1-4-26-19(23)16-13-9-6-12(8-11-15(22)25-3)7-10-14(13)17(18(16)21)20(24)27-5-2/h6-11H,4-5,21H2,1-3H3/b11-8+ |
| InChIKey | DPWBJODWONDKNU-DHZHZOJOSA-N |
| XLogP | 2.91 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|