C19H23NO4 — CID 102239311
diethyl 2-amino-6-propan-2-ylazulene-1,3-dicarboxylate (PubChem CID 102239311) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is diethyl 2-amino-6-propan-2-ylazulene-1,3-dicarboxylate.
| Compound Name | diethyl 2-amino-6-propan-2-ylazulene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 102239311 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | diethyl 2-amino-6-propan-2-ylazulene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1c2ccc(C(C)C)ccc-2c(C(=O)OCC)c1N |
| InChI | InChI=1S/C19H23NO4/c1-5-23-18(21)15-13-9-7-12(11(3)4)8-10-14(13)16(17(15)20)19(22)24-6-2/h7-11H,5-6,20H2,1-4H3 |
| InChIKey | SNYGYTPPZSYSBG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |