C23H28N2O8 — CID 23296763
diethyl 2-amino-6-[2-[(2-ethoxy-2-oxoethoxy)-methylamino]-2-oxoethyl]azulene-1,3-dicarboxylate (PubChem CID 23296763) has the molecular formula C23H28N2O8 and a molecular weight of 460.48 g/mol. Its IUPAC name is diethyl 2-amino-6-[2-[(2-ethoxy-2-oxoethoxy)-methylamino]-2-oxoethyl]azulene-1,3-dicarboxylate.
| Compound Name | diethyl 2-amino-6-[2-[(2-ethoxy-2-oxoethoxy)-methylamino]-2-oxoethyl]azulene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 23296763 |
| Molecular Formula | C23H28N2O8 |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | diethyl 2-amino-6-[2-[(2-ethoxy-2-oxoethoxy)-methylamino]-2-oxoethyl]azulene-1,3-dicarboxylate |
| SMILES | CCOC(=O)CON(C)C(=O)Cc1ccc2c(C(=O)OCC)c(N)c(C(=O)OCC)c-2cc1 |
| InChI | InChI=1S/C23H28N2O8/c1-5-30-18(27)13-33-25(4)17(26)12-14-8-10-15-16(11-9-14)20(23(29)32-7-3)21(24)19(15)22(28)31-6-2/h8-11H,5-7,12-13,24H2,1-4H3 |
| InChIKey | LLPWFBZYZVSUJO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 134.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|