C23H27N5O7 — CID 23296766
diethyl 2-amino-6-[2-[4,5-dihydro-1H-imidazol-2-ylcarbamoyl(methoxy)amino]-2-oxoethyl]azulene-1,3-dicarboxylate (PubChem CID 23296766) has the molecular formula C23H27N5O7 and a molecular weight of 485.50 g/mol. Its IUPAC name is diethyl 2-amino-6-[2-[4,5-dihydro-1H-imidazol-2-ylcarbamoyl(methoxy)amino]-2-oxoethyl]azulene-1,3-dicarboxylate.
| Compound Name | diethyl 2-amino-6-[2-[4,5-dihydro-1H-imidazol-2-ylcarbamoyl(methoxy)amino]-2-oxoethyl]azulene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 23296766 |
| Molecular Formula | C23H27N5O7 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | diethyl 2-amino-6-[2-[4,5-dihydro-1H-imidazol-2-ylcarbamoyl(methoxy)amino]-2-oxoethyl]azulene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1c2ccc(CC(=O)N(OC)C(=O)NC3=NCCN3)ccc-2c(C(=O)OCC)c1N |
| InChI | InChI=1S/C23H27N5O7/c1-4-34-20(30)17-14-8-6-13(7-9-15(14)18(19(17)24)21(31)35-5-2)12-16(29)28(33-3)23(32)27-22-25-10-11-26-22/h6-9H,4-5,10-12,24H2,1-3H3,(H2,25,26,27,32) |
| InChIKey | UDHUQBWBAOCIRX-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 161.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|