C19H22N2NaO6+ — CID 23296754
sodium diethyl 2-amino-6-[2-[hydroxy(methyl)amino]-2-oxoethyl]azulene-1,3-dicarboxylate (PubChem CID 23296754) has the molecular formula C19H22N2NaO6+ and a molecular weight of 397.38 g/mol. Its IUPAC name is sodium diethyl 2-amino-6-[2-[hydroxy(methyl)amino]-2-oxoethyl]azulene-1,3-dicarboxylate.
| Compound Name | sodium diethyl 2-amino-6-[2-[hydroxy(methyl)amino]-2-oxoethyl]azulene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 23296754 |
| Molecular Formula | C19H22N2NaO6+ |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | sodium diethyl 2-amino-6-[2-[hydroxy(methyl)amino]-2-oxoethyl]azulene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1c2ccc(CC(=O)N(C)O)ccc-2c(C(=O)OCC)c1N.[Na+] |
| InChI | InChI=1S/C19H22N2O6.Na/c1-4-26-18(23)15-12-8-6-11(10-14(22)21(3)25)7-9-13(12)16(17(15)20)19(24)27-5-2;/h6-9,25H,4-5,10,20H2,1-3H3;/q;+1 |
| InChIKey | URRJTXFJSIIOLH-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|