C21H26N2O7 — CID 23296764
diethyl 2-amino-6-[2-(3-hydroxypropoxyamino)-2-oxoethyl]azulene-1,3-dicarboxylate (PubChem CID 23296764) has the molecular formula C21H26N2O7 and a molecular weight of 418.45 g/mol. Its IUPAC name is diethyl 2-amino-6-[2-(3-hydroxypropoxyamino)-2-oxoethyl]azulene-1,3-dicarboxylate.
| Compound Name | diethyl 2-amino-6-[2-(3-hydroxypropoxyamino)-2-oxoethyl]azulene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 23296764 |
| Molecular Formula | C21H26N2O7 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | diethyl 2-amino-6-[2-(3-hydroxypropoxyamino)-2-oxoethyl]azulene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1c2ccc(CC(=O)NOCCCO)ccc-2c(C(=O)OCC)c1N |
| InChI | InChI=1S/C21H26N2O7/c1-3-28-20(26)17-14-8-6-13(12-16(25)23-30-11-5-10-24)7-9-15(14)18(19(17)22)21(27)29-4-2/h6-9,24H,3-5,10-12,22H2,1-2H3,(H,23,25) |
| InChIKey | BKUIUILXJYEHJN-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 137.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|