C15H22O6 — CID 66647401
ethyl 3,4-bis(3-hydroxypropoxy)benzoate (PubChem CID 66647401) has the molecular formula C15H22O6 and a molecular weight of 298.34 g/mol. Its IUPAC name is ethyl 3,4-bis(3-hydroxypropoxy)benzoate.
| Compound Name | ethyl 3,4-bis(3-hydroxypropoxy)benzoate |
|---|---|
| PubChem CID | 66647401 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | ethyl 3,4-bis(3-hydroxypropoxy)benzoate |
| SMILES | CCOC(=O)c1ccc(OCCCO)c(OCCCO)c1 |
| InChI | InChI=1S/C15H22O6/c1-2-19-15(18)12-5-6-13(20-9-3-7-16)14(11-12)21-10-4-8-17/h5-6,11,16-17H,2-4,7-10H2,1H3 |
| InChIKey | VNCDYAYOFIHWFN-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|