C14H22NO4+ — CID 23160704
2-(4-ethoxycarbonyl-2-hydroxyphenoxy)ethyl-trimethylazanium (PubChem CID 23160704) has the molecular formula C14H22NO4+ and a molecular weight of 268.33 g/mol. Its IUPAC name is 2-(4-ethoxycarbonyl-2-hydroxyphenoxy)ethyl-trimethylazanium.
| Compound Name | 2-(4-ethoxycarbonyl-2-hydroxyphenoxy)ethyl-trimethylazanium |
|---|---|
| PubChem CID | 23160704 |
| Molecular Formula | C14H22NO4+ |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 2-(4-ethoxycarbonyl-2-hydroxyphenoxy)ethyl-trimethylazanium |
| SMILES | CCOC(=O)c1ccc(OCC[N+](C)(C)C)c(O)c1 |
| InChI | InChI=1S/C14H21NO4/c1-5-18-14(17)11-6-7-13(12(16)10-11)19-9-8-15(2,3)4/h6-7,10H,5,8-9H2,1-4H3/p+1 |
| InChIKey | CNNDVEPLUYEEPS-UHFFFAOYSA-O |
| XLogP | 1.65 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|