C26H30O8 — CID 158916697
ethyl 3,4-dihydroxybenzoate;ethyl 3-hydroxy-4-phenylmethoxybenzoate;methane (PubChem CID 158916697) has the molecular formula C26H30O8 and a molecular weight of 470.52 g/mol. Its IUPAC name is ethyl 3,4-dihydroxybenzoate;ethyl 3-hydroxy-4-phenylmethoxybenzoate;methane.
| Compound Name | ethyl 3,4-dihydroxybenzoate;ethyl 3-hydroxy-4-phenylmethoxybenzoate;methane |
|---|---|
| PubChem CID | 158916697 |
| Molecular Formula | C26H30O8 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | ethyl 3,4-dihydroxybenzoate;ethyl 3-hydroxy-4-phenylmethoxybenzoate;methane |
| SMILES | C.CCOC(=O)c1ccc(O)c(O)c1.CCOC(=O)c1ccc(OCc2ccccc2)c(O)c1 |
| InChI | InChI=1S/C16H16O4.C9H10O4.CH4/c1-2-19-16(18)13-8-9-15(14(17)10-13)20-11-12-6-4-3-5-7-12;1-2-13-9(12)6-3-4-7(10)8(11)5-6;/h3-10,17H,2,11H2,1H3;3-5,10-11H,2H2,1H3;1H4 |
| InChIKey | JHHXCCGJECLEPI-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|