C19H20O5 — CID 11393300
diethyl 5-phenylmethoxybenzene-1,3-dicarboxylate (PubChem CID 11393300) has the molecular formula C19H20O5 and a molecular weight of 328.36 g/mol. Its IUPAC name is diethyl 5-phenylmethoxybenzene-1,3-dicarboxylate.
| Compound Name | diethyl 5-phenylmethoxybenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 11393300 |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | diethyl 5-phenylmethoxybenzene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1cc(OCc2ccccc2)cc(C(=O)OCC)c1 |
| InChI | InChI=1S/C19H20O5/c1-3-22-18(20)15-10-16(19(21)23-4-2)12-17(11-15)24-13-14-8-6-5-7-9-14/h5-12H,3-4,13H2,1-2H3 |
| InChIKey | CMFDQONILFCUAO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |