C35H30O8 — CID 158844750
benzyl 3,5-bis(phenylmethoxy)benzoate;3,5-dihydroxybenzoic acid (PubChem CID 158844750) has the molecular formula C35H30O8 and a molecular weight of 578.62 g/mol. Its IUPAC name is benzyl 3,5-bis(phenylmethoxy)benzoate;3,5-dihydroxybenzoic acid.
| Compound Name | benzyl 3,5-bis(phenylmethoxy)benzoate;3,5-dihydroxybenzoic acid |
|---|---|
| PubChem CID | 158844750 |
| Molecular Formula | C35H30O8 |
| Molecular Weight | 578.62 g/mol |
| Exact Mass | 578.19 |
| IUPAC Name | benzyl 3,5-bis(phenylmethoxy)benzoate;3,5-dihydroxybenzoic acid |
| SMILES | O=C(O)c1cc(O)cc(O)c1.O=C(OCc1ccccc1)c1cc(OCc2ccccc2)cc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C28H24O4.C7H6O4/c29-28(32-21-24-14-8-3-9-15-24)25-16-26(30-19-22-10-4-1-5-11-22)18-27(17-25)31-20-23-12-6-2-7-13-23;8-5-1-4(7(10)11)2-6(9)3-5/h1-18H,19-21H2;1-3,8-9H,(H,10,11) |
| InChIKey | IYRJJEHYBTZEGC-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.62 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |