C54H46O9 — CID 126609644
furan-2-ylmethyl 3,5-bis[[3,5-bis(phenylmethoxy)phenyl]methoxy]benzoate (PubChem CID 126609644) has the molecular formula C54H46O9 and a molecular weight of 838.95 g/mol. Its IUPAC name is furan-2-ylmethyl 3,5-bis[[3,5-bis(phenylmethoxy)phenyl]methoxy]benzoate.
| Compound Name | furan-2-ylmethyl 3,5-bis[[3,5-bis(phenylmethoxy)phenyl]methoxy]benzoate |
|---|---|
| PubChem CID | 126609644 |
| Molecular Formula | C54H46O9 |
| Molecular Weight | 838.95 g/mol |
| Exact Mass | 838.31 |
| IUPAC Name | furan-2-ylmethyl 3,5-bis[[3,5-bis(phenylmethoxy)phenyl]methoxy]benzoate |
| SMILES | O=C(OCc1ccco1)c1cc(OCc2cc(OCc3ccccc3)cc(OCc3ccccc3)c2)cc(OCc2cc(OCc3ccccc3)cc(OCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C54H46O9/c55-54(63-39-47-22-13-23-56-47)46-28-52(61-37-44-24-48(57-33-40-14-5-1-6-15-40)30-49(25-44)58-34-41-16-7-2-8-17-41)32-53(29-46)62-38-45-26-50(59-35-42-18-9-3-10-19-42)31-51(27-45)60-36-43-20-11-4-12-21-43/h1-32H,33-39H2 |
| InChIKey | IFNUNMMMVTWBOR-UHFFFAOYSA-N |
| XLogP | 12.11 |
| TPSA | 94.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.95 |
| LogP ≤ 5 | 12.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |